4-(2-nitrobutyl)morpholine structure
|
Common Name | 4-(2-nitrobutyl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 2224-44-4 | Molecular Weight | 188.22400 | |
| Density | 1.092g/cm3 | Boiling Point | 288.6ºC at 760 mmHg | |
| Molecular Formula | C8H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | 4-(2-nitrobutyl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 288.6ºC at 760 mmHg |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.22400 |
| Flash Point | 128.3ºC |
| Exact Mass | 188.11600 |
| PSA | 58.29000 |
| LogP | 0.83500 |
| Vapour Pressure | 0.00232mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | GQHVWDKJTDUZRP-UHFFFAOYSA-N |
| SMILES | CCC(CN1CCOCC1)[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
|
| HS Code | 2934999090 |
|---|
|
~%
4-(2-nitrobutyl... CAS#:2224-44-4 |
| Literature: Clapp Journal of the American Chemical Society, 1948 , vol. 70, p. 184 Full Text View citing articles Show Details Zief; Mason Journal of Organic Chemistry, 1943 , vol. 8, p. 1,5 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 218-748-3 |
| Vancide F 5386 |
| Vancide 40 |
| N-(2-Nitrobutyl)morpholine |
| 2-Nitobutylmorpholin |
| Morpholine,4-(2-nitrobutyl) |
| 4-(2-Nitro-butyl)-morpholin |
| Caswell No. 601A |
| 4-(2-Nitrobutyl)morpholine |
| 4-(2-nitro-butyl)-morpholine |