n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide structure
|
Common Name | n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2224189-75-5 | Molecular Weight | 195.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17NO2 |
|---|---|
| Molecular Weight | 195.26 |
| InChIKey | RPFBIUCGCVWWAX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1CCC2(CC1)COC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: SMILES notation of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is C=CC(=O)NC1CCC2(CC1)COC2. |
| Q: What is the Chinese name of 2224189-75-5? |
| A: Chinese name of 2224189-75-5 is 2224189-75-5. |
| Q: What is the molecular formula of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: Molecular formula of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is C11H17NO2. |
| Q: What is the CAS number of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: CAS number of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is 2224189-75-5. |
| Q: What is the molecular weight of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: Molecular weight of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is 195.26. |
| Q: What is the English name of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: The English name of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide. |
| Q: What is the InChIKey of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide? |
| A: InChIKey of n-{2-Oxaspiro[3.5]nonan-7-yl}prop-2-enamide is RPFBIUCGCVWWAX-UHFFFAOYSA-N. |