Naphthalene,2-(2,2-dichloroethyl)-1-methyl-4-phenyl- structure
|
Common Name | Naphthalene,2-(2,2-dichloroethyl)-1-methyl-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 22242-71-3 | Molecular Weight | 315.23600 | |
| Density | 1.207g/cm3 | Boiling Point | 439.3ºC at 760 mmHg | |
| Molecular Formula | C19H16Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | 2-(2,2-dichloroethyl)-1-methyl-4-phenylnaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 439.3ºC at 760 mmHg |
| Molecular Formula | C19H16Cl2 |
| Molecular Weight | 315.23600 |
| Flash Point | 230.4ºC |
| Exact Mass | 314.06300 |
| LogP | 6.16140 |
| Vapour Pressure | 1.66E-07mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | IISIUNGMFSDYNO-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(Cl)Cl)cc(-c2ccccc2)c2ccccc12 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Naphthalene,2-(2,2-dichloroethyl)-1-methyl-4-phenyl |
| Naphthalene,2-dichloroethyl)-1-methyl-4-phenyl |