N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide structure
|
Common Name | N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2224362-91-6 | Molecular Weight | 237.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO2S |
|---|---|
| Molecular Weight | 237.32 |
| InChIKey | JHGSSZKBHYYCTM-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N(C)CC1OCCc2sccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: The English name of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide. |
| Q: What is the CAS number of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: CAS number of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is 2224362-91-6. |
| Q: What is the SMILES notation of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: SMILES notation of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is C=CC(=O)N(C)CC1OCCc2sccc21. |
| Q: What is the Chinese name of 2224362-91-6? |
| A: Chinese name of 2224362-91-6 is 2224362-91-6. |
| Q: What is the InChIKey of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: InChIKey of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is JHGSSZKBHYYCTM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: Molecular formula of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is C12H15NO2S. |
| Q: What is the molecular weight of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide? |
| A: Molecular weight of N-(6,7-Dihydro-4H-thieno[3,2-c]pyran-4-ylmethyl)-N-methylprop-2-enamide is 237.32. |