2,3,4-trimethoxy-6-hydroxyacetophenone structure
|
Common Name | 2,3,4-trimethoxy-6-hydroxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 22248-14-2 | Molecular Weight | 226.226 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 366.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8±20.0 °C | |
| Name | 1-(6-Hydroxy-2,3,4-trimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.8±37.0 °C at 760 mmHg |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.226 |
| Flash Point | 140.8±20.0 °C |
| Exact Mass | 226.084122 |
| PSA | 64.99000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | MLYYVUJNBLMMPE-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(C)=O)c(OC)c1OC |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-acetyl-3,4,5-trimethoxyphenol |
| Ethanone, 1-(6-hydroxy-2,3,4-trimethoxyphenyl)- |
| 2'-hydroxy-4',5',6'-trimethoxyacetophenone |
| 1-(6-Hydroxy-2,3,4-trimethoxyphenyl)ethanone |
| 6'-hydroxy-2',3',4'-trimethoxyacetophenone |
| 2,3,4-trimethoxy-6-hydroxyacetophenone |