ethyl (2R)-2-ethoxy-3-(4-hydroxyphenyl)propanoate structure
|
Common Name | ethyl (2R)-2-ethoxy-3-(4-hydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 222555-05-7 | Molecular Weight | 238.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (2R)-2-ethoxy-3-(4-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O4 |
|---|---|
| Molecular Weight | 238.28000 |
| Exact Mass | 238.12100 |
| PSA | 55.76000 |
| LogP | 1.90290 |
| InChIKey | NEJJCKFYYBEQRQ-GFCCVEGCSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)OCC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl (2R)-2-Ethoxy-3-(4-hydroxyphenyl)propanoate |
| ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |
| R(+)-ethyl-2-ethoxy-3-(4-hydroxyphenyl) propanoate |
| (-)-ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |
| (2R)-2-ethoxy-3-(4-hydroxy-phenyl)propionic acid ethyl ester |
| (R)-ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |