2(3H)-Benzothiazolone,3-[2-(benzoyloxy)ethyl] structure
|
Common Name | 2(3H)-Benzothiazolone,3-[2-(benzoyloxy)ethyl] | ||
|---|---|---|---|---|
| CAS Number | 22258-68-0 | Molecular Weight | 299.34400 | |
| Density | 1.327g/cm3 | Boiling Point | 481.6ºC at 760 mmHg | |
| Molecular Formula | C16H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.1ºC | |
| Name | 3-(2-benzoyl-benzoyloxy)-3-phenyl-phthalide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 481.6ºC at 760 mmHg |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.34400 |
| Flash Point | 245.1ºC |
| Exact Mass | 299.06200 |
| PSA | 76.54000 |
| LogP | 2.92000 |
| Vapour Pressure | 1.96E-09mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | SNVVZQINZBPMBH-UHFFFAOYSA-N |
| SMILES | O=C(OCCn1c(=O)sc2ccccc21)c1ccccc1 |
|
~%
2(3H)-Benzothia... CAS#:22258-68-0 |
| Literature: Sohar,P. et al. Journal of Heterocyclic Chemistry, 1969 , vol. 6, p. 163 - 174 |
| 3-Oxo-1-phenyl-1,3-dihydro-2-benzofuran-1-yl 2-benzoylbenzoate |
| 3-(2-benzoyloxy-ethyl)-3H-benzothiazol-2-one |