[[[[(2S,3S,4R,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxola n-2-yl]amino]oxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphon ic acid structure
|
Common Name | [[[[(2S,3S,4R,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxola n-2-yl]amino]oxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphon ic acid | ||
|---|---|---|---|---|
| CAS Number | 2226-74-6 | Molecular Weight | 484.14 | |
| Density | 2.66g/cm3 | Boiling Point | 860.7ºC at 760mmHg | |
| Molecular Formula | C8H15N4O14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 474.4ºC | |
Use of [[[[(2S,3S,4R,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxola n-2-yl]amino]oxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphon ic acid5-Azacytidine 5′-triphosphate (5-aza-CMP) is a cytidine analog that inhibitss the incorporation of [3H]CTP, but not [3H]UTP, into RNA in the DNA-dependent RNA polymerase reaction[1]. |
| Name | 5-Azacytidine 5-Triphosphate DISCONTINUED |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Azacytidine 5′-triphosphate (5-aza-CMP) is a cytidine analog that inhibitss the incorporation of [3H]CTP, but not [3H]UTP, into RNA in the DNA-dependent RNA polymerase reaction[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.66g/cm3 |
|---|---|
| Boiling Point | 860.7ºC at 760mmHg |
| Molecular Formula | C8H15N4O14P3 |
| Molecular Weight | 484.14 |
| Flash Point | 474.4ºC |
| Exact Mass | 483.98000 |
| PSA | 311.88000 |
| Vapour Pressure | 1.57E-34mmHg at 25°C |
| Index of Refraction | 1.848 |
| InChIKey | ISWUHFDEXOSOCJ-BNHYGAARSA-N |
| SMILES | Nc1ccn(C2OC(NOP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2O)c(=O)n1 |
| 5-Azacytidine Triphosphate |
| 5-Azacytidine 5'-Triphosphate DISCONTINUED |
| 5-Aza-cytidin-5'-triphosphat |
| [[[[(2S,3S,4R,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxola n-2-yl]amino]oxy-hydroxy-phosphoryl]oxy-hydroxy-phosphoryl]oxyphosphon ic acid |
| 5'-azacytidine 5'-triphosphate |