2-(2,6-Dioxopiperidin-3-yl)-5-(prop-2-yn-1-yloxy)isoindoline-1,3-dione structure
|
Common Name | 2-(2,6-Dioxopiperidin-3-yl)-5-(prop-2-yn-1-yloxy)isoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 2226303-74-6 | Molecular Weight | 312.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(2,6-Dioxopiperidin-3-yl)-5-(prop-2-yn-1-yloxy)isoindoline-1,3-dioneThalidomide-5-propargyl is a propargyl-modified Thalidomide (HY-14658), that acts as a Cereblon ligand to recruit CRBN proteins. Thalidomide-5-propargyl use alkynyl group at the end to be directly used in the synthesis of triazoles in the synthesis of PROTAC molecules, and is a key intermediate in the synthesis of PROTAC molecules based on CRBN design[1]. |
| Name | Thalidomide-5-propargyl |
|---|---|
| Synonym | More Synonyms |
| Description | Thalidomide-5-propargyl is a propargyl-modified Thalidomide (HY-14658), that acts as a Cereblon ligand to recruit CRBN proteins. Thalidomide-5-propargyl use alkynyl group at the end to be directly used in the synthesis of triazoles in the synthesis of PROTAC molecules, and is a key intermediate in the synthesis of PROTAC molecules based on CRBN design[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon[1] |
| References |
| Molecular Formula | C16H12N2O5 |
|---|---|
| Molecular Weight | 312.28 |
| InChIKey | GDWXJPQKRQMMQW-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Storage condition | 2-8°C |
| 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-(2-propyn-1-yloxy)- |
| 2-(2,6-dioxopiperidin-3-yl)-5-(prop-2-yn-1-yloxy)isoindoline-1,3-dione |