2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole
2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole structure
|
Common Name | 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 2227-71-6 | Molecular Weight | 267.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13NOS |
|---|---|
| Molecular Weight | 267.34600 |
| Exact Mass | 267.07200 |
| PSA | 50.36000 |
| LogP | 4.48570 |
| InChIKey | VIYMRRDTACPLHE-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)cs2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934100090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:2362-64-3
CAS#:7257-94-5
CAS#:70-11-1
CAS#:27088-84-2
CAS#:98-80-6
CAS#:79603-21-7
CAS#:696-62-8
CAS#:98-86-2
CAS#:54883-29-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: Polar surface area (PSA) of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is 50.36000. |
| Q: What is the English name of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: The English name of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole. |
| Q: What is the molecular weight of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: Molecular weight of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is 267.34600. |
| Q: What is the Chinese name of 2227-71-6? |
| A: Chinese name of 2227-71-6 is 2227-71-6. |
| Q: What are the downstream products of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: Related downstream products(CAS) of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole: 54883-29-3. |
| Q: What is the CAS number of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: CAS number of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is 2227-71-6. |
| Q: What is the molecular formula of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: Molecular formula of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is C16H13NOS. |
| Q: What is the LogP of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: LogP of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is 4.48570. |
| Q: What are the upstream materials of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: Related upstream materials(CAS) of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole: 2362-64-3;7257-94-5;70-11-1;27088-84-2;98-80-6;79603-21-7;696-62-8;98-86-2. |
| Q: What is the SMILES notation of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole? |
| A: SMILES notation of 2-(4-methoxyphenyl)-4-phenyl-1,3-thiazole is COc1ccc(-c2nc(-c3ccccc3)cs2)cc1. |