1,4-Naphthalenedione,2-(butylamino)-3-chloro- structure
|
Common Name | 1,4-Naphthalenedione,2-(butylamino)-3-chloro- | ||
|---|---|---|---|---|
| CAS Number | 22272-30-6 | Molecular Weight | 263.71900 | |
| Density | 1.26g/cm3 | Boiling Point | 365.5ºC at 760mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9ºC | |
| Name | 2-(butylamino)-3-chloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 365.5ºC at 760mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 174.9ºC |
| Exact Mass | 263.07100 |
| PSA | 46.17000 |
| LogP | 3.29660 |
| Vapour Pressure | 1.56E-05mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | JCFNCUAAGWEUNO-UHFFFAOYSA-N |
| SMILES | CCCCNC1=C(Cl)C(=O)c2ccccc2C1=O |
|
~89%
1,4-Naphthalene... CAS#:22272-30-6 |
| Literature: Lien, Jin-Cherng; Huang, Li-Jiau; Wang, Jih-Pyang; Teng, Che-Ming; Lee, Kuo-Hsiung; Kou, Sheng-Chu Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 12 p. 2111 - 2120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chlor-2-butylamino-naphthochinon |
| 2N(n-butylamino)-3-chloro-1,4-naphthoquinone |
| 2-(butylamino)-3-chloronaphthoquinone |