6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine
Modify Date: 2025-09-11 14:33:00
![6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine Structure](https://www.chemsrc.com/extcaspic/210/2227365-78-6.png)
6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine structure
|
Common Name | 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 2227365-78-6 | Molecular Weight | 257.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6HCl2F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6HCl2F3N4 |
|---|---|
| Molecular Weight | 257.00 |
| InChIKey | JGYVJGGNVWVJLG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nnc2cc(Cl)c(Cl)nn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: Molecular formula of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is C6HCl2F3N4. |
| Q: What is the CAS number of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: CAS number of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is 2227365-78-6. |
| Q: What is the molecular weight of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: Molecular weight of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is 257.00. |
| Q: What is the SMILES notation of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: SMILES notation of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is FC(F)(F)c1nnc2cc(Cl)c(Cl)nn12. |
| Q: What is the InChIKey of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: InChIKey of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is JGYVJGGNVWVJLG-UHFFFAOYSA-N. |
| Q: What is the English name of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine? |
| A: The English name of 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine is 6,7-Dichloro-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine. |
| Q: What is the Chinese name of 2227365-78-6? |
| A: Chinese name of 2227365-78-6 is 2227365-78-6. |