(3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid structure
|
Common Name | (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2227643-82-3 | Molecular Weight | 464.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H32N2O5 |
|---|---|
| Molecular Weight | 464.6 |
| InChIKey | ZAXZHMXJMDCSCZ-XFAGBWLFSA-N |
| SMILES | CC(CC(=O)O)NC(=O)CC1CCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: SMILES notation of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is CC(CC(=O)O)NC(=O)CC1CCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the Chinese name of 2227643-82-3? |
| A: Chinese name of 2227643-82-3 is 2227643-82-3. |
| Q: What is the molecular formula of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: Molecular formula of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is C27H32N2O5. |
| Q: What is the molecular weight of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: Molecular weight of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is 464.6. |
| Q: What is the InChIKey of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: InChIKey of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is ZAXZHMXJMDCSCZ-XFAGBWLFSA-N. |
| Q: What is the English name of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: The English name of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid. |
| Q: What is the CAS number of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid? |
| A: CAS number of (3S)-3-{2-[(1RS,2RS)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}butanoic acid is 2227643-82-3. |