rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine structure
|
Common Name | rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2227650-03-3 | Molecular Weight | 209.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NS |
|---|---|
| Molecular Weight | 209.35 |
| InChIKey | DACFFWOWIQHXBT-GHMZBOCLSA-N |
| SMILES | CCCc1ccc(C2C(N)C2(C)C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: CAS number of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is 2227650-03-3. |
| Q: What is the InChIKey of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: InChIKey of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is DACFFWOWIQHXBT-GHMZBOCLSA-N. |
| Q: What is the molecular formula of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: Molecular formula of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is C12H19NS. |
| Q: What is the English name of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: The English name of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine. |
| Q: What is the Chinese name of 2227650-03-3? |
| A: Chinese name of 2227650-03-3 is 2227650-03-3. |
| Q: What is the SMILES notation of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: SMILES notation of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is CCCc1ccc(C2C(N)C2(C)C)s1. |
| Q: What is the molecular weight of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine? |
| A: Molecular weight of rac-(1R,3S)-2,2-dimethyl-3-(5-propylthiophen-2-yl)cyclopropan-1-amine is 209.35. |