4H-Pyrrolo[2,3-d]pyrimidine-4-thione,3,7-dihydro-5-nitro- structure
|
Common Name | 4H-Pyrrolo[2,3-d]pyrimidine-4-thione,3,7-dihydro-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 22277-04-9 | Molecular Weight | 196.18700 | |
| Density | 1.95g/cm3 | Boiling Point | 489.7ºC at 760mmHg | |
| Molecular Formula | C6H4N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250ºC | |
| Name | 5-nitro-1,7-dihydropyrrolo[2,3-d]pyrimidine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.95g/cm3 |
|---|---|
| Boiling Point | 489.7ºC at 760mmHg |
| Molecular Formula | C6H4N4O2S |
| Molecular Weight | 196.18700 |
| Flash Point | 250ºC |
| Exact Mass | 196.00500 |
| PSA | 122.38000 |
| LogP | 2.05190 |
| Vapour Pressure | 9.72E-10mmHg at 25°C |
| Index of Refraction | 1.916 |
| InChIKey | ZMAIWNXBVJHOHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c[nH]c2[nH]cnc(=S)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-3,4-dihydro-7H-pyrrolo<2.3-d>pyrimidin-4-thion |