methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate
Modify Date: 2025-09-17 12:40:22
methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate structure
|
Common Name | methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 2227722-58-7 | Molecular Weight | 222.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.24 |
| InChIKey | ABGFBKOKHMFQBS-JTQLQIEISA-N |
| SMILES | COC(=O)CC(O)c1cccc2c1OCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: The English name of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate. |
| Q: What is the SMILES notation of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: SMILES notation of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is COC(=O)CC(O)c1cccc2c1OCC2. |
| Q: What is the Chinese name of 2227722-58-7? |
| A: Chinese name of 2227722-58-7 is 2227722-58-7. |
| Q: What is the InChIKey of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: InChIKey of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is ABGFBKOKHMFQBS-JTQLQIEISA-N. |
| Q: What is the molecular weight of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: Molecular weight of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is 222.24. |
| Q: What is the molecular formula of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: Molecular formula of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is C12H14O4. |
| Q: What is the CAS number of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate? |
| A: CAS number of methyl (3S)-3-(2,3-dihydro-1-benzofuran-7-yl)-3-hydroxypropanoate is 2227722-58-7. |