rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine
Modify Date: 2025-08-20 09:17:26
rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine structure
|
Common Name | rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2227745-69-7 | Molecular Weight | 197.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F2N |
|---|---|
| Molecular Weight | 197.22 |
| InChIKey | DSUGHIKPNMLBTR-UWVGGRQHSA-N |
| SMILES | CC1(C)C(N)C1c1cc(F)ccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2227745-69-7? |
| A: Chinese name of 2227745-69-7 is 2227745-69-7. |
| Q: What is the English name of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: The English name of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine. |
| Q: What is the InChIKey of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: InChIKey of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is DSUGHIKPNMLBTR-UWVGGRQHSA-N. |
| Q: What is the molecular formula of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: Molecular formula of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is C11H13F2N. |
| Q: What is the SMILES notation of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: SMILES notation of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is CC1(C)C(N)C1c1cc(F)ccc1F. |
| Q: What is the CAS number of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: CAS number of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is 2227745-69-7. |
| Q: What is the molecular weight of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine? |
| A: Molecular weight of rac-(1R,3R)-3-(2,5-difluorophenyl)-2,2-dimethylcyclopropan-1-amine is 197.22. |