rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid
Modify Date: 2025-10-14 09:24:21
rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid structure
|
Common Name | rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2227770-21-8 | Molecular Weight | 271.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11BrO3 |
|---|---|
| Molecular Weight | 271.11 |
| InChIKey | NNMKYFUDKZEPCB-IONNQARKSA-N |
| SMILES | COc1ccc(Br)c(C2CC2C(=O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: Molecular formula of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is C11H11BrO3. |
| Q: What is the CAS number of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: CAS number of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is 2227770-21-8. |
| Q: What is the English name of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: The English name of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid. |
| Q: What is the molecular weight of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: Molecular weight of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is 271.11. |
| Q: What is the SMILES notation of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: SMILES notation of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is COc1ccc(Br)c(C2CC2C(=O)O)c1. |
| Q: What is the InChIKey of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid? |
| A: InChIKey of rac-(1R,2R)-2-(2-bromo-5-methoxyphenyl)cyclopropane-1-carboxylic acid is NNMKYFUDKZEPCB-IONNQARKSA-N. |
| Q: What is the Chinese name of 2227770-21-8? |
| A: Chinese name of 2227770-21-8 is 2227770-21-8. |