rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate
Modify Date: 2025-08-26 12:27:06
rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate structure
|
Common Name | rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2227770-25-2 | Molecular Weight | 253.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16ClNO2 |
|---|---|
| Molecular Weight | 253.72 |
| InChIKey | BXJKCHOLCZJGKU-NWDGAFQWSA-N |
| SMILES | CCOC(=O)C1CNCC1c1cccc(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: Molecular formula of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is C13H16ClNO2. |
| Q: What is the English name of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: The English name of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate. |
| Q: What is the SMILES notation of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: SMILES notation of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is CCOC(=O)C1CNCC1c1cccc(Cl)c1. |
| Q: What is the Chinese name of 2227770-25-2? |
| A: Chinese name of 2227770-25-2 is 2227770-25-2. |
| Q: What is the CAS number of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: CAS number of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is 2227770-25-2. |
| Q: What is the molecular weight of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: Molecular weight of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is 253.72. |
| Q: What is the InChIKey of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate? |
| A: InChIKey of rac-ethyl (3R,4S)-4-(3-chlorophenyl)pyrrolidine-3-carboxylate is BXJKCHOLCZJGKU-NWDGAFQWSA-N. |