(2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol
Modify Date: 2026-07-04 18:58:52
(2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol structure
|
Common Name | (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 2227770-81-0 | Molecular Weight | 193.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO |
|---|---|
| Molecular Weight | 193.28 |
| InChIKey | QCKNJDKGFQZWQQ-NSHDSACASA-N |
| SMILES | Cc1cc(C)c(CC(O)CN)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2227770-81-0? |
| A: Chinese name of 2227770-81-0 is 2227770-81-0. |
| Q: What is the SMILES notation of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: SMILES notation of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is Cc1cc(C)c(CC(O)CN)c(C)c1. |
| Q: What is the English name of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: The English name of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol. |
| Q: What is the InChIKey of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: InChIKey of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is QCKNJDKGFQZWQQ-NSHDSACASA-N. |
| Q: What is the CAS number of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: CAS number of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is 2227770-81-0. |
| Q: What is the molecular weight of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: Molecular weight of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is 193.28. |
| Q: What is the molecular formula of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol? |
| A: Molecular formula of (2S)-1-amino-3-(2,4,6-trimethylphenyl)propan-2-ol is C12H19NO. |