rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate
Modify Date: 2026-07-04 09:54:08
![rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/252/2227770-86-5.png)
rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate structure
|
Common Name | rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2227770-86-5 | Molecular Weight | 266.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19FN2O2 |
|---|---|
| Molecular Weight | 266.31 |
| InChIKey | ULDZHYRUCIIIJY-CMPLNLGQSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C2CC2N)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: CAS number of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is 2227770-86-5. |
| Q: What is the SMILES notation of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: SMILES notation of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is CC(C)(C)OC(=O)Nc1ccc(C2CC2N)c(F)c1. |
| Q: What is the molecular weight of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: Molecular weight of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is 266.31. |
| Q: What is the molecular formula of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: Molecular formula of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is C14H19FN2O2. |
| Q: What is the Chinese name of 2227770-86-5? |
| A: Chinese name of 2227770-86-5 is 2227770-86-5. |
| Q: What is the InChIKey of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: InChIKey of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is ULDZHYRUCIIIJY-CMPLNLGQSA-N. |
| Q: What is the English name of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate? |
| A: The English name of rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate is rac-tert-butyl N-{4-[(1R,2S)-2-aminocyclopropyl]-3-fluorophenyl}carbamate. |