tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate
Modify Date: 2026-07-15 17:11:36
![tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/138/2227770-89-8.png)
tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate structure
|
Common Name | tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2227770-89-8 | Molecular Weight | 249.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO3 |
|---|---|
| Molecular Weight | 249.30 |
| InChIKey | WBYOCJSRIYCMCZ-LBPRGKRZSA-N |
| SMILES | Cc1ccc(C2CO2)cc1NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: InChIKey of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is WBYOCJSRIYCMCZ-LBPRGKRZSA-N. |
| Q: What is the CAS number of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: CAS number of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is 2227770-89-8. |
| Q: What is the molecular weight of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: Molecular weight of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is 249.30. |
| Q: What is the SMILES notation of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: SMILES notation of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is Cc1ccc(C2CO2)cc1NC(=O)OC(C)(C)C. |
| Q: What is the molecular formula of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: Molecular formula of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is C14H19NO3. |
| Q: What is the English name of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate? |
| A: The English name of tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate is tert-butyl N-{2-methyl-5-[(2R)-oxiran-2-yl]phenyl}carbamate. |
| Q: What is the Chinese name of 2227770-89-8? |
| A: Chinese name of 2227770-89-8 is 2227770-89-8. |