rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine
Modify Date: 2026-08-05 11:47:14
![rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine Structure](https://www.chemsrc.com/extcaspic/100/2227777-25-3.png)
rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine structure
|
Common Name | rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2227777-25-3 | Molecular Weight | 193.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19N3 |
|---|---|
| Molecular Weight | 193.29 |
| InChIKey | QYZKFUMYSZTDMA-NXEZZACHSA-N |
| SMILES | Cc1nn(C(C)C)c(C)c1C1CC1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: InChIKey of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is QYZKFUMYSZTDMA-NXEZZACHSA-N. |
| Q: What is the CAS number of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: CAS number of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is 2227777-25-3. |
| Q: What is the molecular weight of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: Molecular weight of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is 193.29. |
| Q: What is the Chinese name of 2227777-25-3? |
| A: Chinese name of 2227777-25-3 is 2227777-25-3. |
| Q: What is the molecular formula of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: Molecular formula of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is C11H19N3. |
| Q: What is the English name of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: The English name of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine. |
| Q: What is the SMILES notation of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine? |
| A: SMILES notation of rac-(1R,2S)-2-[3,5-dimethyl-1-(propan-2-yl)-1H-pyrazol-4-yl]cyclopropan-1-amine is Cc1nn(C(C)C)c(C)c1C1CC1N. |