rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate
Modify Date: 2025-10-03 16:40:24
rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate structure
|
Common Name | rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2227781-65-7 | Molecular Weight | 297.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO3S |
|---|---|
| Molecular Weight | 297.4 |
| InChIKey | YRLWARBENRWVQC-VXGBXAGGSA-N |
| SMILES | Cc1csc(C)c1C1CN(C(=O)OC(C)(C)C)CC1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: Molecular formula of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is C15H23NO3S. |
| Q: What is the CAS number of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: CAS number of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is 2227781-65-7. |
| Q: What is the InChIKey of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: InChIKey of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is YRLWARBENRWVQC-VXGBXAGGSA-N. |
| Q: What is the SMILES notation of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: SMILES notation of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is Cc1csc(C)c1C1CN(C(=O)OC(C)(C)C)CC1O. |
| Q: What is the molecular weight of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: Molecular weight of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is 297.4. |
| Q: What is the English name of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate? |
| A: The English name of rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate is rac-tert-butyl (3R,4S)-3-(2,4-dimethylthiophen-3-yl)-4-hydroxypyrrolidine-1-carboxylate. |
| Q: What is the Chinese name of 2227781-65-7? |
| A: Chinese name of 2227781-65-7 is 2227781-65-7. |