(1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol
Modify Date: 2026-08-29 09:27:01
(1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol structure
|
Common Name | (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2227809-63-2 | Molecular Weight | 247.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Cl2F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3Cl2F3N2O |
|---|---|
| Molecular Weight | 247.00 |
| InChIKey | BIXNAEBEXPOWPF-SCSAIBSYSA-N |
| SMILES | OC(c1cc(Cl)nnc1Cl)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: The English name of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol. |
| Q: What is the Chinese name of 2227809-63-2? |
| A: Chinese name of 2227809-63-2 is 2227809-63-2. |
| Q: What is the molecular formula of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: Molecular formula of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is C6H3Cl2F3N2O. |
| Q: What is the molecular weight of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: Molecular weight of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is 247.00. |
| Q: What is the SMILES notation of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: SMILES notation of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is OC(c1cc(Cl)nnc1Cl)C(F)(F)F. |
| Q: What is the InChIKey of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: InChIKey of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is BIXNAEBEXPOWPF-SCSAIBSYSA-N. |
| Q: What is the CAS number of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol? |
| A: CAS number of (1R)-1-(3,6-dichloropyridazin-4-yl)-2,2,2-trifluoroethan-1-ol is 2227809-63-2. |