5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol
Modify Date: 2026-07-12 20:06:31
![5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol Structure](https://www.chemsrc.com/extcaspic/484/2227823-19-8.png)
5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol structure
|
Common Name | 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 2227823-19-8 | Molecular Weight | 222.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F3O3 |
|---|---|
| Molecular Weight | 222.16 |
| InChIKey | JWBIRCVCMRZGGI-MRVPVSSYSA-N |
| SMILES | COc1ccc(C(O)C(F)(F)F)c(O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2227823-19-8? |
| A: Chinese name of 2227823-19-8 is 2227823-19-8. |
| Q: What is the SMILES notation of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: SMILES notation of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is COc1ccc(C(O)C(F)(F)F)c(O)c1. |
| Q: What is the English name of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: The English name of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol. |
| Q: What is the molecular formula of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: Molecular formula of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is C9H9F3O3. |
| Q: What is the molecular weight of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: Molecular weight of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is 222.16. |
| Q: What is the CAS number of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: CAS number of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is 2227823-19-8. |
| Q: What is the InChIKey of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol? |
| A: InChIKey of 5-methoxy-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenol is JWBIRCVCMRZGGI-MRVPVSSYSA-N. |