rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine
Modify Date: 2025-10-25 10:01:29
![rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine Structure](https://www.chemsrc.com/extcaspic/225/2227863-23-0.png)
rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine structure
|
Common Name | rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 2227863-23-0 | Molecular Weight | 234.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15ClN2 |
|---|---|
| Molecular Weight | 234.72 |
| InChIKey | CMDOKUHHTCZSFF-GZMMTYOYSA-N |
| SMILES | Cn1cc(C2CC2CN)c2ccc(Cl)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: CAS number of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is 2227863-23-0. |
| Q: What is the English name of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: The English name of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine. |
| Q: What is the Chinese name of 2227863-23-0? |
| A: Chinese name of 2227863-23-0 is 2227863-23-0. |
| Q: What is the SMILES notation of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: SMILES notation of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is Cn1cc(C2CC2CN)c2ccc(Cl)cc21. |
| Q: What is the molecular formula of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: Molecular formula of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is C13H15ClN2. |
| Q: What is the InChIKey of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: InChIKey of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is CMDOKUHHTCZSFF-GZMMTYOYSA-N. |
| Q: What is the molecular weight of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine? |
| A: Molecular weight of rac-[(1R,2R)-2-(6-chloro-1-methyl-1H-indol-3-yl)cyclopropyl]methanamine is 234.72. |