rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid
Modify Date: 2026-04-15 00:14:18
![rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/053/2227872-16-2.png)
rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid structure
|
Common Name | rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2227872-16-2 | Molecular Weight | 264.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClF3O2 |
|---|---|
| Molecular Weight | 264.63 |
| InChIKey | UEXJMMQELGQEFB-POYBYMJQSA-N |
| SMILES | O=C(O)C1CC1c1cc(C(F)(F)F)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: Molecular formula of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is C11H8ClF3O2. |
| Q: What is the Chinese name of 2227872-16-2? |
| A: Chinese name of 2227872-16-2 is 2227872-16-2. |
| Q: What is the SMILES notation of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: SMILES notation of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is O=C(O)C1CC1c1cc(C(F)(F)F)ccc1Cl. |
| Q: What is the English name of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: The English name of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. |
| Q: What is the molecular weight of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: Molecular weight of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is 264.63. |
| Q: What is the InChIKey of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: InChIKey of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is UEXJMMQELGQEFB-POYBYMJQSA-N. |
| Q: What is the CAS number of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid? |
| A: CAS number of rac-(1R,2R)-2-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid is 2227872-16-2. |