rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate
Modify Date: 2026-08-20 09:48:57
rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate structure
|
Common Name | rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2227872-19-5 | Molecular Weight | 249.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO3 |
|---|---|
| Molecular Weight | 249.30 |
| InChIKey | SENMPTAECURBRO-OLZOCXBDSA-N |
| SMILES | CCOC(=O)C1CCc2cc(OC)ccc2C1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: SMILES notation of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is CCOC(=O)C1CCc2cc(OC)ccc2C1N. |
| Q: What is the molecular weight of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: Molecular weight of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is 249.30. |
| Q: What is the InChIKey of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: InChIKey of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is SENMPTAECURBRO-OLZOCXBDSA-N. |
| Q: What is the Chinese name of 2227872-19-5? |
| A: Chinese name of 2227872-19-5 is 2227872-19-5. |
| Q: What is the English name of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: The English name of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate. |
| Q: What is the molecular formula of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: Molecular formula of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is C14H19NO3. |
| Q: What is the CAS number of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate? |
| A: CAS number of rac-ethyl (1R,2R)-1-amino-6-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate is 2227872-19-5. |