tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate
Modify Date: 2026-08-19 22:08:41
![tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/046/2227913-48-4.png)
tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate structure
|
Common Name | tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2227913-48-4 | Molecular Weight | 281.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO4 |
|---|---|
| Molecular Weight | 281.35 |
| InChIKey | HDWDBTMOGPOHFS-JTQLQIEISA-N |
| SMILES | CC(O)CCc1ccc(NC(=O)OC(C)(C)C)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: Molecular weight of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is 281.35. |
| Q: What is the InChIKey of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: InChIKey of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is HDWDBTMOGPOHFS-JTQLQIEISA-N. |
| Q: What is the CAS number of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: CAS number of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is 2227913-48-4. |
| Q: What is the Chinese name of 2227913-48-4? |
| A: Chinese name of 2227913-48-4 is 2227913-48-4. |
| Q: What is the SMILES notation of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: SMILES notation of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is CC(O)CCc1ccc(NC(=O)OC(C)(C)C)cc1O. |
| Q: What is the English name of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: The English name of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate. |
| Q: What is the molecular formula of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate? |
| A: Molecular formula of tert-butyl N-{3-hydroxy-4-[(3S)-3-hydroxybutyl]phenyl}carbamate is C15H23NO4. |