9H-Purine-6-aceticacid, ethyl ester structure
|
Common Name | 9H-Purine-6-aceticacid, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2228-04-8 | Molecular Weight | 206.20100 | |
| Density | 1.44g/cm3 | Boiling Point | 329ºC at 760mmHg | |
| Molecular Formula | C9H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | ethyl 2-(7H-purin-6-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 329ºC at 760mmHg |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20100 |
| Flash Point | 160ºC |
| Exact Mass | 206.08000 |
| PSA | 80.76000 |
| LogP | 0.45850 |
| Vapour Pressure | 0.000182mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | RHFRJECVHLOADI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ncnc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~93%
9H-Purine-6-ace... CAS#:2228-04-8 |
| Literature: Hasnik, Zbynek; Pohl, Radek; Klepetarova, Blanka; Hocek, Michal Collection of Czechoslovak Chemical Communications, 2009 , vol. 74, # 7-8 p. 1035 - 1059 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (7(9)H-purin-6-yl)-acetic acid ethyl ester |
| ETHYL (9H-PURIN-6-YL)ACETATE |
| 9H-Purine-6-aceticacid,ethyl ester |
| Purin-6-essigsaeure-aethylester |
| 6-[2-(ethoxycarbonyl)methyl]-9H-purine |
| Ethyl 2-(9H-purin-6-yl)acetate |