2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid
Modify Date: 2025-09-17 14:39:34
2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid structure
|
Common Name | 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228083-46-1 | Molecular Weight | 279.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11BrN2O2S |
|---|---|
| Molecular Weight | 279.16 |
| InChIKey | VOMLNQQXFTWREM-UHFFFAOYSA-N |
| SMILES | CC(C)(c1csc(Br)n1)C(N)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: SMILES notation of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is CC(C)(c1csc(Br)n1)C(N)C(=O)O. |
| Q: What is the molecular weight of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: Molecular weight of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is 279.16. |
| Q: What is the English name of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: The English name of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid. |
| Q: What is the Chinese name of 2228083-46-1? |
| A: Chinese name of 2228083-46-1 is 2228083-46-1. |
| Q: What is the InChIKey of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: InChIKey of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is VOMLNQQXFTWREM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: Molecular formula of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is C8H11BrN2O2S. |
| Q: What is the CAS number of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid? |
| A: CAS number of 2-Amino-3-(2-bromo-1,3-thiazol-4-yl)-3-methylbutanoic acid is 2228083-46-1. |