2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid
Modify Date: 2025-09-17 07:13:58
2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid structure
|
Common Name | 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228091-69-6 | Molecular Weight | 214.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N2O2S |
|---|---|
| Molecular Weight | 214.29 |
| InChIKey | OBLXMQZJXASCES-UHFFFAOYSA-N |
| SMILES | Cc1ncc(C(C)(C)C(N)C(=O)O)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: CAS number of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is 2228091-69-6. |
| Q: What is the molecular formula of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: Molecular formula of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is C9H14N2O2S. |
| Q: What is the SMILES notation of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: SMILES notation of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is Cc1ncc(C(C)(C)C(N)C(=O)O)s1. |
| Q: What is the InChIKey of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: InChIKey of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is OBLXMQZJXASCES-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: The English name of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid. |
| Q: What is the Chinese name of 2228091-69-6? |
| A: Chinese name of 2228091-69-6 is 2228091-69-6. |
| Q: What is the molecular weight of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid? |
| A: Molecular weight of 2-Amino-3-methyl-3-(2-methyl-1,3-thiazol-5-yl)butanoic acid is 214.29. |