2-Amino-3-cyclopentyl-3-methylbutanoic acid
Modify Date: 2025-08-27 13:44:58
2-Amino-3-cyclopentyl-3-methylbutanoic acid structure
|
Common Name | 2-Amino-3-cyclopentyl-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228108-65-2 | Molecular Weight | 185.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-3-cyclopentyl-3-methylbutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H19NO2 |
|---|---|
| Molecular Weight | 185.26 |
| InChIKey | MDKITCKYPOJLLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CCCC1)C(N)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: CAS number of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is 2228108-65-2. |
| Q: What is the InChIKey of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: InChIKey of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is MDKITCKYPOJLLO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228108-65-2? |
| A: Chinese name of 2228108-65-2 is 2228108-65-2. |
| Q: What is the molecular formula of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: Molecular formula of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is C10H19NO2. |
| Q: What is the SMILES notation of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: SMILES notation of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is CC(C)(C1CCCC1)C(N)C(=O)O. |
| Q: What is the molecular weight of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: Molecular weight of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is 185.26. |
| Q: What is the English name of 2-Amino-3-cyclopentyl-3-methylbutanoic acid? |
| A: The English name of 2-Amino-3-cyclopentyl-3-methylbutanoic acid is 2-Amino-3-cyclopentyl-3-methylbutanoic acid. |