Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate
Modify Date: 2026-07-03 20:15:42
Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate structure
|
Common Name | Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 2228111-21-3 | Molecular Weight | 244.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O3S |
|---|---|
| Molecular Weight | 244.31 |
| InChIKey | SKNYLOISTWUBMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)C(C)(C)c1cnc(OC)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: Molecular formula of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is C10H16N2O3S. |
| Q: What is the CAS number of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: CAS number of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is 2228111-21-3. |
| Q: What is the English name of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: The English name of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate. |
| Q: What is the Chinese name of 2228111-21-3? |
| A: Chinese name of 2228111-21-3 is 2228111-21-3. |
| Q: What is the molecular weight of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: Molecular weight of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is 244.31. |
| Q: What is the InChIKey of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: InChIKey of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is SKNYLOISTWUBMU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate? |
| A: SMILES notation of Methyl 2-amino-3-(2-methoxy-1,3-thiazol-5-yl)-3-methylbutanoate is COC(=O)C(N)C(C)(C)c1cnc(OC)s1. |