5-methyl-1H-pyrazol-3-yl sulfamate
Modify Date: 2026-08-20 18:51:14
5-methyl-1H-pyrazol-3-yl sulfamate structure
|
Common Name | 5-methyl-1H-pyrazol-3-yl sulfamate | ||
|---|---|---|---|---|
| CAS Number | 2228121-27-3 | Molecular Weight | 177.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-1H-pyrazol-3-yl sulfamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4H7N3O3S |
|---|---|
| Molecular Weight | 177.18 |
| InChIKey | MXDXQECKSBEMLN-UHFFFAOYSA-N |
| SMILES | Cc1cc(OS(N)(=O)=O)n[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: Molecular formula of 5-methyl-1H-pyrazol-3-yl sulfamate is C4H7N3O3S. |
| Q: What is the InChIKey of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: InChIKey of 5-methyl-1H-pyrazol-3-yl sulfamate is MXDXQECKSBEMLN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: Molecular weight of 5-methyl-1H-pyrazol-3-yl sulfamate is 177.18. |
| Q: What is the English name of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: The English name of 5-methyl-1H-pyrazol-3-yl sulfamate is 5-methyl-1H-pyrazol-3-yl sulfamate. |
| Q: What is the CAS number of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: CAS number of 5-methyl-1H-pyrazol-3-yl sulfamate is 2228121-27-3. |
| Q: What is the Chinese name of 2228121-27-3? |
| A: Chinese name of 2228121-27-3 is 2228121-27-3. |
| Q: What is the SMILES notation of 5-methyl-1H-pyrazol-3-yl sulfamate? |
| A: SMILES notation of 5-methyl-1H-pyrazol-3-yl sulfamate is Cc1cc(OS(N)(=O)=O)n[nH]1. |