Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate
Modify Date: 2026-07-17 09:20:25
![Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate Structure](https://www.chemsrc.com/extcaspic/334/2228126-45-0.png)
Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate structure
|
Common Name | Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 2228126-45-0 | Molecular Weight | 237.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16FNO2 |
|---|---|
| Molecular Weight | 237.27 |
| InChIKey | RPVJSQDMLBNQBD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)C1(c2cc(C)ccc2F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: Molecular weight of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is 237.27. |
| Q: What is the English name of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: The English name of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate. |
| Q: What is the molecular formula of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: Molecular formula of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is C13H16FNO2. |
| Q: What is the InChIKey of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: InChIKey of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is RPVJSQDMLBNQBD-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: CAS number of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is 2228126-45-0. |
| Q: What is the SMILES notation of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate? |
| A: SMILES notation of Methyl 2-amino-2-[1-(2-fluoro-5-methylphenyl)cyclopropyl]acetate is COC(=O)C(N)C1(c2cc(C)ccc2F)CC1. |
| Q: What is the Chinese name of 2228126-45-0? |
| A: Chinese name of 2228126-45-0 is 2228126-45-0. |