2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid
Modify Date: 2026-08-03 16:54:42
2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid structure
|
Common Name | 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228126-47-2 | Molecular Weight | 191.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H17NO4 |
|---|---|
| Molecular Weight | 191.22 |
| InChIKey | UOUMTGILNWXXOE-UHFFFAOYSA-N |
| SMILES | COC(OC)C(C)(C)C(N)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228126-47-2? |
| A: Chinese name of 2228126-47-2 is 2228126-47-2. |
| Q: What is the molecular weight of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: Molecular weight of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is 191.22. |
| Q: What is the molecular formula of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: Molecular formula of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is C8H17NO4. |
| Q: What is the InChIKey of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: InChIKey of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is UOUMTGILNWXXOE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: CAS number of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is 2228126-47-2. |
| Q: What is the English name of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: The English name of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid. |
| Q: What is the SMILES notation of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid? |
| A: SMILES notation of 2-Amino-4,4-dimethoxy-3,3-dimethylbutanoic acid is COC(OC)C(C)(C)C(N)C(=O)O. |