2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid
Modify Date: 2026-07-24 11:25:25
![2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid Structure](https://www.chemsrc.com/extcaspic/013/2228126-58-5.png)
2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid structure
|
Common Name | 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228126-58-5 | Molecular Weight | 209.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.28 |
| InChIKey | VRFVPLGVLKCNLP-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CC=C(CC(N)C(=O)O)C1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: Molecular formula of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is C12H19NO2. |
| Q: What is the CAS number of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: CAS number of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is 2228126-58-5. |
| Q: What is the English name of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: The English name of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid. |
| Q: What is the InChIKey of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: InChIKey of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is VRFVPLGVLKCNLP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: SMILES notation of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is CC1(C)C2CC=C(CC(N)C(=O)O)C1C2. |
| Q: What is the molecular weight of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid? |
| A: Molecular weight of 2-Amino-3-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}propanoic acid is 209.28. |
| Q: What is the Chinese name of 2228126-58-5? |
| A: Chinese name of 2228126-58-5 is 2228126-58-5. |