Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate
Modify Date: 2025-10-23 17:37:04
Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate structure
|
Common Name | Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 2228126-59-6 | Molecular Weight | 217.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H23NO3 |
|---|---|
| Molecular Weight | 217.31 |
| InChIKey | UQLWVQHHFOVOPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)C(C)(C)CC(C)(C)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228126-59-6? |
| A: Chinese name of 2228126-59-6 is 2228126-59-6. |
| Q: What is the SMILES notation of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: SMILES notation of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is COC(=O)C(N)C(C)(C)CC(C)(C)OC. |
| Q: What is the InChIKey of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: InChIKey of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is UQLWVQHHFOVOPH-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: The English name of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate. |
| Q: What is the molecular formula of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: Molecular formula of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is C11H23NO3. |
| Q: What is the CAS number of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: CAS number of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is 2228126-59-6. |
| Q: What is the molecular weight of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate? |
| A: Molecular weight of Methyl 2-amino-5-methoxy-3,3,5-trimethylhexanoate is 217.31. |