3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid
Modify Date: 2025-11-06 18:46:53
3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid structure
|
Common Name | 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228126-74-5 | Molecular Weight | 190.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14O5 |
|---|---|
| Molecular Weight | 190.19 |
| InChIKey | ZIZYOUNQFJIGNH-UHFFFAOYSA-N |
| SMILES | CC1(C)OCC(C(O)CC(=O)O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: CAS number of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is 2228126-74-5. |
| Q: What is the SMILES notation of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: SMILES notation of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is CC1(C)OCC(C(O)CC(=O)O)O1. |
| Q: What is the English name of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: The English name of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid. |
| Q: What is the InChIKey of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: InChIKey of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is ZIZYOUNQFJIGNH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228126-74-5? |
| A: Chinese name of 2228126-74-5 is 2228126-74-5. |
| Q: What is the molecular formula of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: Molecular formula of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is C8H14O5. |
| Q: What is the molecular weight of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid? |
| A: Molecular weight of 3-(2,2-Dimethyl-1,3-dioxolan-4-yl)-3-hydroxypropanoic acid is 190.19. |