Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate
Modify Date: 2025-09-11 18:07:56
![Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate Structure](https://www.chemsrc.com/extcaspic/413/2228126-92-7.png)
Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate structure
|
Common Name | Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate | ||
|---|---|---|---|---|
| CAS Number | 2228126-92-7 | Molecular Weight | 243.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17N3O2S |
|---|---|
| Molecular Weight | 243.33 |
| InChIKey | VCWGAARZSDBJCJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(N)c1cnc(N(C)C)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: InChIKey of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is VCWGAARZSDBJCJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228126-92-7? |
| A: Chinese name of 2228126-92-7 is 2228126-92-7. |
| Q: What is the SMILES notation of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: SMILES notation of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is COC(=O)CCC(N)c1cnc(N(C)C)s1. |
| Q: What is the CAS number of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: CAS number of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is 2228126-92-7. |
| Q: What is the molecular formula of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: Molecular formula of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is C10H17N3O2S. |
| Q: What is the English name of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: The English name of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate. |
| Q: What is the molecular weight of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate? |
| A: Molecular weight of Methyl 4-amino-4-[2-(dimethylamino)-1,3-thiazol-5-yl]butanoate is 243.33. |