4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine
Modify Date: 2026-09-30 11:51:15
4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine structure
|
Common Name | 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2228139-68-0 | Molecular Weight | 224.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2OS |
|---|---|
| Molecular Weight | 224.32 |
| InChIKey | IVJRHSMNMRWYOL-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)c1sc(N(C)C)nc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: The English name of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine. |
| Q: What is the molecular formula of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: Molecular formula of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is C11H16N2OS. |
| Q: What is the SMILES notation of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: SMILES notation of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is C#CC(C)(C)c1sc(N(C)C)nc1OC. |
| Q: What is the InChIKey of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: InChIKey of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is IVJRHSMNMRWYOL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228139-68-0? |
| A: Chinese name of 2228139-68-0 is 2228139-68-0. |
| Q: What is the molecular weight of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: Molecular weight of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is 224.32. |
| Q: What is the CAS number of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine? |
| A: CAS number of 4-methoxy-N,N-dimethyl-5-(2-methylbut-3-yn-2-yl)-1,3-thiazol-2-amine is 2228139-68-0. |