2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol
Modify Date: 2026-07-11 06:49:49
![2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol Structure](https://www.chemsrc.com/extcaspic/226/2228142-47-8.png)
2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol structure
|
Common Name | 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2228142-47-8 | Molecular Weight | 214.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N2OS |
|---|---|
| Molecular Weight | 214.33 |
| InChIKey | CSCQARMEBYRIHW-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cnc(C(C)(C)CO)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: SMILES notation of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is CN(C)Cc1cnc(C(C)(C)CO)s1. |
| Q: What is the InChIKey of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: InChIKey of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is CSCQARMEBYRIHW-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: The English name of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol. |
| Q: What is the molecular weight of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: Molecular weight of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is 214.33. |
| Q: What is the molecular formula of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: Molecular formula of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is C10H18N2OS. |
| Q: What is the Chinese name of 2228142-47-8? |
| A: Chinese name of 2228142-47-8 is 2228142-47-8. |
| Q: What is the CAS number of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol? |
| A: CAS number of 2-{5-[(Dimethylamino)methyl]-1,3-thiazol-2-yl}-2-methylpropan-1-ol is 2228142-47-8. |