3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol
Modify Date: 2026-08-22 18:05:47
![3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol Structure](https://www.chemsrc.com/extcaspic/331/2228150-41-0.png)
3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol structure
|
Common Name | 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 2228150-41-0 | Molecular Weight | 265.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14F3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14F3NOS |
|---|---|
| Molecular Weight | 265.30 |
| InChIKey | AFKGKJRDNLIIAR-UHFFFAOYSA-N |
| SMILES | OC1(Cc2ccc(C(F)(F)F)s2)CCCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: SMILES notation of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is OC1(Cc2ccc(C(F)(F)F)s2)CCCNC1. |
| Q: What is the molecular formula of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: Molecular formula of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is C11H14F3NOS. |
| Q: What is the English name of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: The English name of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol. |
| Q: What is the CAS number of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: CAS number of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is 2228150-41-0. |
| Q: What is the Chinese name of 2228150-41-0? |
| A: Chinese name of 2228150-41-0 is 2228150-41-0. |
| Q: What is the molecular weight of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: Molecular weight of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is 265.30. |
| Q: What is the InChIKey of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol? |
| A: InChIKey of 3-{[5-(Trifluoromethyl)thiophen-2-yl]methyl}piperidin-3-ol is AFKGKJRDNLIIAR-UHFFFAOYSA-N. |