tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate
Modify Date: 2025-09-01 16:43:59
![tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate Structure](https://www.chemsrc.com/extcaspic/145/2228203-33-4.png)
tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate structure
|
Common Name | tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2228203-33-4 | Molecular Weight | 296.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21ClN2O2 |
|---|---|
| Molecular Weight | 296.79 |
| InChIKey | JKXCCRIJGCAMDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CC2CNC2)ccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: InChIKey of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is JKXCCRIJGCAMDP-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: The English name of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate. |
| Q: What is the Chinese name of 2228203-33-4? |
| A: Chinese name of 2228203-33-4 is 2228203-33-4. |
| Q: What is the molecular weight of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: Molecular weight of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is 296.79. |
| Q: What is the SMILES notation of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: SMILES notation of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is CC(C)(C)OC(=O)Nc1cc(CC2CNC2)ccc1Cl. |
| Q: What is the molecular formula of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: Molecular formula of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is C15H21ClN2O2. |
| Q: What is the CAS number of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate? |
| A: CAS number of tert-butyl N-{5-[(azetidin-3-yl)methyl]-2-chlorophenyl}carbamate is 2228203-33-4. |