3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine
Modify Date: 2026-07-18 17:38:59
3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine structure
|
Common Name | 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2228207-90-5 | Molecular Weight | 244.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClF2N2 |
|---|---|
| Molecular Weight | 244.67 |
| InChIKey | ZWIOZIZAPYGRSE-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)Cc1c[nH]c2cc(Cl)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228207-90-5? |
| A: Chinese name of 2228207-90-5 is 2228207-90-5. |
| Q: What is the molecular formula of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: Molecular formula of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is C11H11ClF2N2. |
| Q: What is the CAS number of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: CAS number of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is 2228207-90-5. |
| Q: What is the InChIKey of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: InChIKey of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is ZWIOZIZAPYGRSE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: SMILES notation of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is NCC(F)(F)Cc1c[nH]c2cc(Cl)ccc12. |
| Q: What is the English name of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: The English name of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine. |
| Q: What is the molecular weight of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine? |
| A: Molecular weight of 3-(6-chloro-1H-indol-3-yl)-2,2-difluoropropan-1-amine is 244.67. |