4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine
Modify Date: 2026-07-25 18:17:45
4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine structure
|
Common Name | 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2228208-24-8 | Molecular Weight | 240.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9ClN2OS |
|---|---|
| Molecular Weight | 240.71 |
| InChIKey | WONBYJWGEOEVMX-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cccc1-c1csc(N)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: InChIKey of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is WONBYJWGEOEVMX-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: The English name of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine. |
| Q: What is the CAS number of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: CAS number of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is 2228208-24-8. |
| Q: What is the molecular weight of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: Molecular weight of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is 240.71. |
| Q: What is the molecular formula of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: Molecular formula of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is C10H9ClN2OS. |
| Q: What is the SMILES notation of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine? |
| A: SMILES notation of 4-(3-Chloro-2-methoxyphenyl)-1,3-thiazol-2-amine is COc1c(Cl)cccc1-c1csc(N)n1. |
| Q: What is the Chinese name of 2228208-24-8? |
| A: Chinese name of 2228208-24-8 is 2228208-24-8. |