3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one
Modify Date: 2025-08-27 10:15:34
3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one structure
|
Common Name | 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2228223-57-0 | Molecular Weight | 197.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15N5O |
|---|---|
| Molecular Weight | 197.24 |
| InChIKey | OHEKXMXSRKLHPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)n1nnc(C(=O)CCN)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: SMILES notation of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is CC(C)(C)n1nnc(C(=O)CCN)n1. |
| Q: What is the molecular weight of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: Molecular weight of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is 197.24. |
| Q: What is the molecular formula of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: Molecular formula of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is C8H15N5O. |
| Q: What is the InChIKey of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: InChIKey of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is OHEKXMXSRKLHPS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228223-57-0? |
| A: Chinese name of 2228223-57-0 is 2228223-57-0. |
| Q: What is the English name of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: The English name of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one. |
| Q: What is the CAS number of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one? |
| A: CAS number of 3-amino-1-(2-tert-butyl-2H-1,2,3,4-tetrazol-5-yl)propan-1-one is 2228223-57-0. |