3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid
Modify Date: 2026-08-02 17:22:46
3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid structure
|
Common Name | 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2228234-95-3 | Molecular Weight | 252.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClF3O2 |
|---|---|
| Molecular Weight | 252.62 |
| InChIKey | YRVYXUGUVUHKDF-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1cccc(F)c1Cl)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2228234-95-3? |
| A: Chinese name of 2228234-95-3 is 2228234-95-3. |
| Q: What is the English name of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: The English name of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid. |
| Q: What is the CAS number of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: CAS number of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is 2228234-95-3. |
| Q: What is the SMILES notation of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: SMILES notation of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is O=C(O)CC(c1cccc(F)c1Cl)C(F)F. |
| Q: What is the molecular weight of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: Molecular weight of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is 252.62. |
| Q: What is the InChIKey of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: InChIKey of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is YRVYXUGUVUHKDF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid? |
| A: Molecular formula of 3-(2-Chloro-3-fluorophenyl)-4,4-difluorobutanoic acid is C10H8ClF3O2. |